C10H14O8 — CID 87073553
2-(2-acetyloxy-2-oxoethyl)-4-ethoxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 87073553) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is 2-(2-acetyloxy-2-oxoethyl)-4-ethoxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 2-(2-acetyloxy-2-oxoethyl)-4-ethoxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87073553 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(2-acetyloxy-2-oxoethyl)-4-ethoxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(O)(CC(=O)OC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H14O8/c1-3-17-7(12)4-10(16,9(14)15)5-8(13)18-6(2)11/h16H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | JMDNEIHFSKUQGD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|