C14H26O10 — CID 88670105
2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid;hexane-1,1,1-triol (PubChem CID 88670105) has the molecular formula C14H26O10 and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid;hexane-1,1,1-triol.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid;hexane-1,1,1-triol |
|---|---|
| PubChem CID | 88670105 |
| Molecular Formula | C14H26O10 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid;hexane-1,1,1-triol |
| SMILES | CCCCCC(O)(O)O.CCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O7.C6H14O3/c1-2-15-6(11)4-8(14,7(12)13)3-5(9)10;1-2-3-4-5-6(7,8)9/h14H,2-4H2,1H3,(H,9,10)(H,12,13);7-9H,2-5H2,1H3 |
| InChIKey | AWNDKTHESILPAH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|