C36H63N3O23 — CID 173247388
tris(2-(2-aminooxy-2-oxoethyl)-2-hydroxybutanedioic acid);octadecanoic acid (PubChem CID 173247388) has the molecular formula C36H63N3O23 and a molecular weight of 905.90 g/mol. Its IUPAC name is tris(2-(2-aminooxy-2-oxoethyl)-2-hydroxybutanedioic acid);octadecanoic acid.
| Compound Name | tris(2-(2-aminooxy-2-oxoethyl)-2-hydroxybutanedioic acid);octadecanoic acid |
|---|---|
| PubChem CID | 173247388 |
| Molecular Formula | C36H63N3O23 |
| Molecular Weight | 905.90 g/mol |
| Exact Mass | 905.39 |
| IUPAC Name | tris(2-(2-aminooxy-2-oxoethyl)-2-hydroxybutanedioic acid);octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.NOC(=O)CC(O)(CC(=O)O)C(=O)O.NOC(=O)CC(O)(CC(=O)O)C(=O)O.NOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H36O2.3C6H9NO7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*7-14-4(10)2-6(13,5(11)12)1-3(8)9/h2-17H2,1H3,(H,19,20);3*13H,1-2,7H2,(H,8,9)(H,11,12) |
| InChIKey | OXBWKEMPLYCYBX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 478.75 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.90 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|