C16H27NaO9 — CID 162001356
sodium;3-carboxy-3,5-dihydroxy-5-oxopentanoate;decanoic acid (PubChem CID 162001356) has the molecular formula C16H27NaO9 and a molecular weight of 386.37 g/mol. Its IUPAC name is sodium;3-carboxy-3,5-dihydroxy-5-oxopentanoate;decanoic acid.
| Compound Name | sodium;3-carboxy-3,5-dihydroxy-5-oxopentanoate;decanoic acid |
|---|---|
| PubChem CID | 162001356 |
| Molecular Formula | C16H27NaO9 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | sodium;3-carboxy-3,5-dihydroxy-5-oxopentanoate;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.O=C([O-])CC(O)(CC(=O)O)C(=O)O.[Na+] |
| InChI | InChI=1S/C10H20O2.C6H8O7.Na/c1-2-3-4-5-6-7-8-9-10(11)12;7-3(8)1-6(13,5(11)12)2-4(9)10;/h2-9H2,1H3,(H,11,12);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+1/p-1 |
| InChIKey | RTWRTFCIJVFTMW-UHFFFAOYSA-M |
| XLogP | -2.37 |
| TPSA | 172.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|