C26H46O11 — CID 175125683
dioctyl butanedioate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175125683) has the molecular formula C26H46O11 and a molecular weight of 534.64 g/mol. Its IUPAC name is dioctyl butanedioate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | dioctyl butanedioate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175125683 |
| Molecular Formula | C26H46O11 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | dioctyl butanedioate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCOC(=O)CCC(=O)OCCCCCCCC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H38O4.C6H8O7/c1-3-5-7-9-11-13-17-23-19(21)15-16-20(22)24-18-14-12-10-8-6-4-2;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-18H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OERGMELWVZJITM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|