C19H34O7 — CID 151183118
2-(2-decoxy-2-oxoethyl)-2-hydroxy-4-oxo-4-propoxybutanoic acid (PubChem CID 151183118) has the molecular formula C19H34O7 and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-(2-decoxy-2-oxoethyl)-2-hydroxy-4-oxo-4-propoxybutanoic acid.
| Compound Name | 2-(2-decoxy-2-oxoethyl)-2-hydroxy-4-oxo-4-propoxybutanoic acid |
|---|---|
| PubChem CID | 151183118 |
| Molecular Formula | C19H34O7 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-(2-decoxy-2-oxoethyl)-2-hydroxy-4-oxo-4-propoxybutanoic acid |
| SMILES | CCCCCCCCCCOC(=O)CC(O)(CC(=O)OCCC)C(=O)O |
| InChI | InChI=1S/C19H34O7/c1-3-5-6-7-8-9-10-11-13-26-17(21)15-19(24,18(22)23)14-16(20)25-12-4-2/h24H,3-15H2,1-2H3,(H,22,23) |
| InChIKey | NESMCTQSVLCRQK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|