C20H30O14 — CID 87104965
2-[2-[8-(3,4-dicarboxy-3-hydroxybutanoyl)oxyoctoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87104965) has the molecular formula C20H30O14 and a molecular weight of 494.45 g/mol. Its IUPAC name is 2-[2-[8-(3,4-dicarboxy-3-hydroxybutanoyl)oxyoctoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[8-(3,4-dicarboxy-3-hydroxybutanoyl)oxyoctoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87104965 |
| Molecular Formula | C20H30O14 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[2-[8-(3,4-dicarboxy-3-hydroxybutanoyl)oxyoctoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCCCCCCCOC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H30O14/c21-13(22)9-19(31,17(27)28)11-15(25)33-7-5-3-1-2-4-6-8-34-16(26)12-20(32,18(29)30)10-14(23)24/h31-32H,1-12H2,(H,21,22)(H,23,24)(H,27,28)(H,29,30) |
| InChIKey | NSOFXAWJAAYROR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|