C15H26O7 — CID 91461249
2-hydroxy-2-[2-(7-methyloctoxy)-2-oxoethyl]butanedioic acid (PubChem CID 91461249) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-hydroxy-2-[2-(7-methyloctoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-(7-methyloctoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 91461249 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-hydroxy-2-[2-(7-methyloctoxy)-2-oxoethyl]butanedioic acid |
| SMILES | CC(C)CCCCCCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26O7/c1-11(2)7-5-3-4-6-8-22-13(18)10-15(21,14(19)20)9-12(16)17/h11,21H,3-10H2,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | VYUSVSUCHUKMBN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|