C13H21FO7 — CID 162199838
2-[2-(7-fluoroheptoxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 162199838) has the molecular formula C13H21FO7 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[2-(7-fluoroheptoxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(7-fluoroheptoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 162199838 |
| Molecular Formula | C13H21FO7 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[2-(7-fluoroheptoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCCCCCCF)C(=O)O |
| InChI | InChI=1S/C13H21FO7/c14-6-4-2-1-3-5-7-21-11(17)9-13(20,12(18)19)8-10(15)16/h20H,1-9H2,(H,15,16)(H,18,19) |
| InChIKey | GBVOIDXOUWZMSN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|