C16H22O14 — CID 87105264
2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxybutoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87105264) has the molecular formula C16H22O14 and a molecular weight of 438.34 g/mol. Its IUPAC name is 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxybutoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxybutoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87105264 |
| Molecular Formula | C16H22O14 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxybutoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCCCOC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22O14/c17-9(18)5-15(27,13(23)24)7-11(21)29-3-1-2-4-30-12(22)8-16(28,14(25)26)6-10(19)20/h27-28H,1-8H2,(H,17,18)(H,19,20)(H,23,24)(H,25,26) |
| InChIKey | OLWYSOLYGFBLIL-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|