C8H15NO8 — CID 175234551
azane;2-hydroxy-2-[2-(2-hydroxyethoxy)-2-oxoethyl]butanedioic acid (PubChem CID 175234551) has the molecular formula C8H15NO8 and a molecular weight of 253.21 g/mol. Its IUPAC name is azane;2-hydroxy-2-[2-(2-hydroxyethoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | azane;2-hydroxy-2-[2-(2-hydroxyethoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 175234551 |
| Molecular Formula | C8H15NO8 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | azane;2-hydroxy-2-[2-(2-hydroxyethoxy)-2-oxoethyl]butanedioic acid |
| SMILES | N.O=C(O)CC(O)(CC(=O)OCCO)C(=O)O |
| InChI | InChI=1S/C8H12O8.H3N/c9-1-2-16-6(12)4-8(15,7(13)14)3-5(10)11;/h9,15H,1-4H2,(H,10,11)(H,13,14);1H3 |
| InChIKey | ASEZKMVYCYEPBT-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |