C11H20Fe2NO7+ — CID 174882172
2-(3,4-dicarboxy-3-hydroxybutanoyl)oxyethyl-trimethylazanium;iron (PubChem CID 174882172) has the molecular formula C11H20Fe2NO7+ and a molecular weight of 389.97 g/mol. Its IUPAC name is 2-(3,4-dicarboxy-3-hydroxybutanoyl)oxyethyl-trimethylazanium;iron.
| Compound Name | 2-(3,4-dicarboxy-3-hydroxybutanoyl)oxyethyl-trimethylazanium;iron |
|---|---|
| PubChem CID | 174882172 |
| Molecular Formula | C11H20Fe2NO7+ |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 2-(3,4-dicarboxy-3-hydroxybutanoyl)oxyethyl-trimethylazanium;iron |
| SMILES | C[N+](C)(C)CCOC(=O)CC(O)(CC(=O)O)C(=O)O.[Fe].[Fe] |
| InChI | InChI=1S/C11H19NO7.2Fe/c1-12(2,3)4-5-19-9(15)7-11(18,10(16)17)6-8(13)14;;/h18H,4-7H2,1-3H3,(H-,13,14,16,17);;/p+1 |
| InChIKey | NTNXKABPVIDRRM-UHFFFAOYSA-O |
| XLogP | -1.09 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|