C11H19NO7 — CID 155973919
3,5-dihydroxy-5-oxo-3-[2-(trimethylazaniumyl)ethoxycarbonyl]pentanoate (PubChem CID 155973919) has the molecular formula C11H19NO7 and a molecular weight of 277.27 g/mol. Its IUPAC name is 3,5-dihydroxy-5-oxo-3-[2-(trimethylazaniumyl)ethoxycarbonyl]pentanoate.
| Compound Name | 3,5-dihydroxy-5-oxo-3-[2-(trimethylazaniumyl)ethoxycarbonyl]pentanoate |
|---|---|
| PubChem CID | 155973919 |
| Molecular Formula | C11H19NO7 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3,5-dihydroxy-5-oxo-3-[2-(trimethylazaniumyl)ethoxycarbonyl]pentanoate |
| SMILES | C[N+](C)(C)CCOC(=O)C(O)(CC(=O)[O-])CC(=O)O |
| InChI | InChI=1S/C11H19NO7/c1-12(2,3)4-5-19-10(17)11(18,6-8(13)14)7-9(15)16/h18H,4-7H2,1-3H3,(H-,13,14,15,16) |
| InChIKey | FRNDYIKVKURGSD-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|