C14H14CaO14-2 — CID 156625244
calcium 3-[2-[3-carboxylato-2-(carboxylatomethyl)-2-hydroxypropanoyl]oxyethoxycarbonyl]-3-hydroxypentanedioate (PubChem CID 156625244) has the molecular formula C14H14CaO14-2 and a molecular weight of 446.33 g/mol. Its IUPAC name is calcium 3-[2-[3-carboxylato-2-(carboxylatomethyl)-2-hydroxypropanoyl]oxyethoxycarbonyl]-3-hydroxypentanedioate.
| Compound Name | calcium 3-[2-[3-carboxylato-2-(carboxylatomethyl)-2-hydroxypropanoyl]oxyethoxycarbonyl]-3-hydroxypentanedioate |
|---|---|
| PubChem CID | 156625244 |
| Molecular Formula | C14H14CaO14-2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | calcium 3-[2-[3-carboxylato-2-(carboxylatomethyl)-2-hydroxypropanoyl]oxyethoxycarbonyl]-3-hydroxypentanedioate |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)OCCOC(=O)C(O)(CC(=O)[O-])CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C14H18O14.Ca/c15-7(16)3-13(25,4-8(17)18)11(23)27-1-2-28-12(24)14(26,5-9(19)20)6-10(21)22;/h25-26H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22);/q;+2/p-4 |
| InChIKey | IPOPNOAXYUBIJW-UHFFFAOYSA-J |
| XLogP | -8.29 |
| TPSA | 253.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | -8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|