C6H5Cu2O7- — CID 21120021
bis(copper(1+));2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 21120021) has the molecular formula C6H5Cu2O7- and a molecular weight of 316.19 g/mol. Its IUPAC name is bis(copper(1+));2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | bis(copper(1+));2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 21120021 |
| Molecular Formula | C6H5Cu2O7- |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 314.86 |
| IUPAC Name | bis(copper(1+));2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Cu+].[Cu+] |
| InChI | InChI=1S/C6H8O7.2Cu/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-3 |
| InChIKey | DTGJLGAPUYNLAN-UHFFFAOYSA-K |
| XLogP | -5.26 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |