C6H5AlNaO7+ — CID 23327033
aluminum;sodium;2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 23327033) has the molecular formula C6H5AlNaO7+ and a molecular weight of 239.07 g/mol. Its IUPAC name is aluminum;sodium;2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | aluminum;sodium;2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 23327033 |
| Molecular Formula | C6H5AlNaO7+ |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | aluminum;sodium;2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Al+3].[Na+] |
| InChI | InChI=1S/C6H8O7.Al.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;+3;+1/p-3 |
| InChIKey | HZBXPDNXGZYKOD-UHFFFAOYSA-K |
| XLogP | -8.63 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | -8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |