C6H5NaO7Th+2 — CID 3056942
sodium;2-hydroxypropane-1,2,3-tricarboxylate;thorium(4+) (PubChem CID 3056942) has the molecular formula C6H5NaO7Th+2 and a molecular weight of 444.13 g/mol. Its IUPAC name is sodium;2-hydroxypropane-1,2,3-tricarboxylate;thorium(4+).
| Compound Name | sodium;2-hydroxypropane-1,2,3-tricarboxylate;thorium(4+) |
|---|---|
| PubChem CID | 3056942 |
| Molecular Formula | C6H5NaO7Th+2 |
| Molecular Weight | 444.13 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | sodium;2-hydroxypropane-1,2,3-tricarboxylate;thorium(4+) |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Na+].[Th+4] |
| InChI | InChI=1S/C6H8O7.Na.Th/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;+1;+4/p-3 |
| InChIKey | KIPNXNQHLFKRCV-UHFFFAOYSA-K |
| XLogP | -8.25 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.13 |
| LogP ≤ 5 | -8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |