C6H6MgO7 — CID 91886505
magnesium 2-(carboxymethyl)-2-hydroxybutanedioate (PubChem CID 91886505) has the molecular formula C6H6MgO7 and a molecular weight of 214.41 g/mol. Its IUPAC name is magnesium 2-(carboxymethyl)-2-hydroxybutanedioate.
| Compound Name | magnesium 2-(carboxymethyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 91886505 |
| Molecular Formula | C6H6MgO7 |
| Molecular Weight | 214.41 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | magnesium 2-(carboxymethyl)-2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C6H8O7.Mg/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | DIXGJWCZQHXZNR-UHFFFAOYSA-L |
| XLogP | -4.30 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.41 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |