C6H6CuNaO7 — CID 139596389
sodium;2-(carboxymethyl)-2-hydroxybutanedioate;copper(1+) (PubChem CID 139596389) has the molecular formula C6H6CuNaO7 and a molecular weight of 276.64 g/mol. Its IUPAC name is sodium;2-(carboxymethyl)-2-hydroxybutanedioate;copper(1+).
| Compound Name | sodium;2-(carboxymethyl)-2-hydroxybutanedioate;copper(1+) |
|---|---|
| PubChem CID | 139596389 |
| Molecular Formula | C6H6CuNaO7 |
| Molecular Weight | 276.64 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | sodium;2-(carboxymethyl)-2-hydroxybutanedioate;copper(1+) |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)[O-].[Cu+].[Na+] |
| InChI | InChI=1S/C6H8O7.Cu.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | OFFXOAFOXHNZRU-UHFFFAOYSA-L |
| XLogP | -6.92 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.64 |
| LogP ≤ 5 | -6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |