C12H14CuO14 — CID 159582063
copper bis(2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate) (PubChem CID 159582063) has the molecular formula C12H14CuO14 and a molecular weight of 445.78 g/mol. Its IUPAC name is copper bis(2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate).
| Compound Name | copper bis(2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate) |
|---|---|
| PubChem CID | 159582063 |
| Molecular Formula | C12H14CuO14 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | copper bis(2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate) |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)[O-].O=C(O)CC(O)(CC(=O)O)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C6H8O7.Cu/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+2/p-2 |
| InChIKey | MJDJBHCQWNXQIA-UHFFFAOYSA-L |
| XLogP | -5.17 |
| TPSA | 269.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |