C6H10KO7P — CID 172750704
potassium;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;phosphane (PubChem CID 172750704) has the molecular formula C6H10KO7P and a molecular weight of 264.21 g/mol. Its IUPAC name is potassium;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;phosphane.
| Compound Name | potassium;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;phosphane |
|---|---|
| PubChem CID | 172750704 |
| Molecular Formula | C6H10KO7P |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | potassium;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;phosphane |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)[O-].P.[K+] |
| InChI | InChI=1S/C6H8O7.K.H3P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H3/q;+1;/p-1 |
| InChIKey | KIFMEJBJYYXGPI-UHFFFAOYSA-M |
| XLogP | -5.52 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|