C18H27NO7 — CID 173148456
2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;tetrakis(prop-2-enyl)azanium (PubChem CID 173148456) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;tetrakis(prop-2-enyl)azanium.
| Compound Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;tetrakis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 173148456 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.O=C(O)CC(O)(CC(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C12H20N.C6H8O7/c1-5-9-13(10-6-2,11-7-3)12-8-4;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-8H,1-4,9-12H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/q+1;/p-1 |
| InChIKey | QQWKUMDRYQHCJW-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|