About sulfane;tetrakis(prop-2-enyl)azanium
sulfane;tetrakis(prop-2-enyl)azanium (PubChem CID 174809251) has the molecular formula C12H22NS+
and a molecular weight of 212.38 g/mol. Its IUPAC name is sulfane;tetrakis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | sulfane;tetrakis(prop-2-enyl)azanium |
| PubChem CID | 174809251 |
| Molecular Formula | C12H22NS+ |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | sulfane;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.S |
| InChI | InChI=1S/C12H20N.H2S/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-8H,1-4,9-12H2;1H2/q+1; |
| InChIKey | SEKCQZQGETXPEZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze sulfane;tetrakis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;tetrakis(prop-2-enyl)azanium?
The IUPAC name of sulfane;tetrakis(prop-2-enyl)azanium (CID 174809251) is sulfane;tetrakis(prop-2-enyl)azanium.
What is the SMILES notation for sulfane;tetrakis(prop-2-enyl)azanium?
The canonical SMILES for sulfane;tetrakis(prop-2-enyl)azanium is C=CC[N+](CC=C)(CC=C)CC=C.S.
What is the InChIKey of sulfane;tetrakis(prop-2-enyl)azanium?
The InChIKey is SEKCQZQGETXPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.H2S/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-8H,1-4,9-12H2;1H2/q+1;.
What are the key properties of sulfane;tetrakis(prop-2-enyl)azanium?
sulfane;tetrakis(prop-2-enyl)azanium has a molecular weight of 212.38 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;tetrakis(prop-2-enyl)azanium is sourced from PubChem (CID 174809251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).