C14H26ClNO2 — CID 175142733
ethane-1,2-diol;tetrakis(prop-2-enyl)azanium;chloride (PubChem CID 175142733) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is ethane-1,2-diol;tetrakis(prop-2-enyl)azanium;chloride.
| Compound Name | ethane-1,2-diol;tetrakis(prop-2-enyl)azanium;chloride |
|---|---|
| PubChem CID | 175142733 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | ethane-1,2-diol;tetrakis(prop-2-enyl)azanium;chloride |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.OCCO.[Cl-] |
| InChI | InChI=1S/C12H20N.C2H6O2.ClH/c1-5-9-13(10-6-2,11-7-3)12-8-4;3-1-2-4;/h5-8H,1-4,9-12H2;3-4H,1-2H2;1H/q+1;;/p-1 |
| InChIKey | CXBAIYKWJJCMGO-UHFFFAOYSA-M |
| XLogP | -1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|