About but-1-ene;tetrakis(prop-2-enyl)azanium
but-1-ene;tetrakis(prop-2-enyl)azanium (PubChem CID 174931498) has the molecular formula C16H28N+
and a molecular weight of 234.41 g/mol. Its IUPAC name is but-1-ene;tetrakis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | but-1-ene;tetrakis(prop-2-enyl)azanium |
| PubChem CID | 174931498 |
| Molecular Formula | C16H28N+ |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | but-1-ene;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CCC.C=CC[N+](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C12H20N.C4H8/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-4-2/h5-8H,1-4,9-12H2;3H,1,4H2,2H3/q+1; |
| InChIKey | ZTEFSZUEXRSMFW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;tetrakis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;tetrakis(prop-2-enyl)azanium?
The IUPAC name of but-1-ene;tetrakis(prop-2-enyl)azanium (CID 174931498) is but-1-ene;tetrakis(prop-2-enyl)azanium.
What is the SMILES notation for but-1-ene;tetrakis(prop-2-enyl)azanium?
The canonical SMILES for but-1-ene;tetrakis(prop-2-enyl)azanium is C=CCC.C=CC[N+](CC=C)(CC=C)CC=C.
What is the InChIKey of but-1-ene;tetrakis(prop-2-enyl)azanium?
The InChIKey is ZTEFSZUEXRSMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.C4H8/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-4-2/h5-8H,1-4,9-12H2;3H,1,4H2,2H3/q+1;.
What are the key properties of but-1-ene;tetrakis(prop-2-enyl)azanium?
but-1-ene;tetrakis(prop-2-enyl)azanium has a molecular weight of 234.41 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;tetrakis(prop-2-enyl)azanium is sourced from PubChem (CID 174931498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).