About but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride
but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride (PubChem CID 174921131) has the molecular formula C11H24ClN
and a molecular weight of 205.77 g/mol. Its IUPAC name is but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride.
Molecular Properties
| Compound Name | but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride |
| PubChem CID | 174921131 |
| Molecular Formula | C11H24ClN |
| Molecular Weight | 205.77 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride |
| SMILES | C=CCC.C=CC[N+](C)(C)CC.[Cl-] |
| InChI | InChI=1S/C7H16N.C4H8.ClH/c1-5-7-8(3,4)6-2;1-3-4-2;/h5H,1,6-7H2,2-4H3;3H,1,4H2,2H3;1H/q+1;;/p-1 |
| InChIKey | ZKWIOIWVSHHIRV-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.77 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride?
The IUPAC name of but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride (CID 174921131) is but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride.
What is the SMILES notation for but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride?
The canonical SMILES for but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride is C=CCC.C=CC[N+](C)(C)CC.[Cl-].
What is the InChIKey of but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride?
The InChIKey is ZKWIOIWVSHHIRV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16N.C4H8.ClH/c1-5-7-8(3,4)6-2;1-3-4-2;/h5H,1,6-7H2,2-4H3;3H,1,4H2,2H3;1H/q+1;;/p-1.
What are the key properties of but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride?
but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride has a molecular weight of 205.77 g/mol, XLogP of -0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethyl-dimethyl-prop-2-enylazanium;chloride is sourced from PubChem (CID 174921131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).