About methyl-tris(prop-2-enyl)azanium;chloride;hydrate
methyl-tris(prop-2-enyl)azanium;chloride;hydrate (PubChem CID 139647541) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is methyl-tris(prop-2-enyl)azanium;chloride;hydrate.
Molecular Properties
| Compound Name | methyl-tris(prop-2-enyl)azanium;chloride;hydrate |
| PubChem CID | 139647541 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | methyl-tris(prop-2-enyl)azanium;chloride;hydrate |
| SMILES | C=CC[N+](C)(CC=C)CC=C.O.[Cl-] |
| InChI | InChI=1S/C10H18N.ClH.H2O/c1-5-8-11(4,9-6-2)10-7-3;;/h5-7H,1-3,8-10H2,4H3;1H;1H2/q+1;;/p-1 |
| InChIKey | AIQPUDOPWDAHLW-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl-tris(prop-2-enyl)azanium;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tris(prop-2-enyl)azanium;chloride;hydrate?
The IUPAC name of methyl-tris(prop-2-enyl)azanium;chloride;hydrate (CID 139647541) is methyl-tris(prop-2-enyl)azanium;chloride;hydrate.
What is the SMILES notation for methyl-tris(prop-2-enyl)azanium;chloride;hydrate?
The canonical SMILES for methyl-tris(prop-2-enyl)azanium;chloride;hydrate is C=CC[N+](C)(CC=C)CC=C.O.[Cl-].
What is the InChIKey of methyl-tris(prop-2-enyl)azanium;chloride;hydrate?
The InChIKey is AIQPUDOPWDAHLW-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18N.ClH.H2O/c1-5-8-11(4,9-6-2)10-7-3;;/h5-7H,1-3,8-10H2,4H3;1H;1H2/q+1;;/p-1.
What are the key properties of methyl-tris(prop-2-enyl)azanium;chloride;hydrate?
methyl-tris(prop-2-enyl)azanium;chloride;hydrate has a molecular weight of 205.73 g/mol, XLogP of -1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tris(prop-2-enyl)azanium;chloride;hydrate is sourced from PubChem (CID 139647541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).