C17H28ClN3O2 — CID 23434977
methyl-tris(prop-2-enyl)azanium;N-[(prop-2-enoylamino)methyl]prop-2-enamide;chloride (PubChem CID 23434977) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is methyl-tris(prop-2-enyl)azanium;N-[(prop-2-enoylamino)methyl]prop-2-enamide;chloride.
| Compound Name | methyl-tris(prop-2-enyl)azanium;N-[(prop-2-enoylamino)methyl]prop-2-enamide;chloride |
|---|---|
| PubChem CID | 23434977 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | methyl-tris(prop-2-enyl)azanium;N-[(prop-2-enoylamino)methyl]prop-2-enamide;chloride |
| SMILES | C=CC(=O)NCNC(=O)C=C.C=CC[N+](C)(CC=C)CC=C.[Cl-] |
| InChI | InChI=1S/C10H18N.C7H10N2O2.ClH/c1-5-8-11(4,9-6-2)10-7-3;1-3-6(10)8-5-9-7(11)4-2;/h5-7H,1-3,8-10H2,4H3;3-4H,1-2,5H2,(H,8,10)(H,9,11);1H/q+1;;/p-1 |
| InChIKey | YCGFLDVPDQBMHH-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|