C7H10N2NaO2 — CID 173161904
CID 173161904 (PubChem CID 173161904) has the molecular formula C7H10N2NaO2 and a molecular weight of 177.16 g/mol.
| Compound Name | CID 173161904 |
|---|---|
| PubChem CID | 173161904 |
| Molecular Formula | C7H10N2NaO2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NCNC(=O)C=C.[Na] |
| InChI | InChI=1S/C7H10N2O2.Na/c1-3-6(10)8-5-9-7(11)4-2;/h3-4H,1-2,5H2,(H,8,10)(H,9,11); |
| InChIKey | VMVZTUJDFGVOAH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|