C5H9NO3 — CID 22929468
N-(2,2-dihydroxyethyl)prop-2-enamide (PubChem CID 22929468) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is N-(2,2-dihydroxyethyl)prop-2-enamide.
| Compound Name | N-(2,2-dihydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 22929468 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | N-(2,2-dihydroxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(O)O |
| InChI | InChI=1S/C5H9NO3/c1-2-4(7)6-3-5(8)9/h2,5,8-9H,1,3H2,(H,6,7) |
| InChIKey | TZEKUJKAULMISU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|