C6H12N2O2 — CID 130759182
N-(3-amino-2-hydroxypropyl)prop-2-enamide (PubChem CID 130759182) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is N-(3-amino-2-hydroxypropyl)prop-2-enamide.
| Compound Name | N-(3-amino-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 130759182 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N-(3-amino-2-hydroxypropyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(O)CN |
| InChI | InChI=1S/C6H12N2O2/c1-2-6(10)8-4-5(9)3-7/h2,5,9H,1,3-4,7H2,(H,8,10) |
| InChIKey | JJZQRTQZMUPHRP-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|