C8H12N2O3 — CID 87314754
N-[2-hydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide (PubChem CID 87314754) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is N-[2-hydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 87314754 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-[2-hydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(O)NC(=O)C=C |
| InChI | InChI=1S/C8H12N2O3/c1-3-6(11)9-5-8(13)10-7(12)4-2/h3-4,8,13H,1-2,5H2,(H,9,11)(H,10,12) |
| InChIKey | OPRGMQVINPCCKA-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|