C6H11NO5S — CID 54121753
3-hydroxy-3-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 54121753) has the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. Its IUPAC name is 3-hydroxy-3-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | 3-hydroxy-3-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54121753 |
| Molecular Formula | C6H11NO5S |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-hydroxy-3-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(O)CCS(=O)(=O)O |
| InChI | InChI=1S/C6H11NO5S/c1-2-5(8)7-6(9)3-4-13(10,11)12/h2,6,9H,1,3-4H2,(H,7,8)(H,10,11,12) |
| InChIKey | NOEUGVVNEOZZNQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|