C7H15NO5S — CID 175329174
2-hydroxypropane-1-sulfonic acid;N-methylprop-2-enamide (PubChem CID 175329174) has the molecular formula C7H15NO5S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-hydroxypropane-1-sulfonic acid;N-methylprop-2-enamide.
| Compound Name | 2-hydroxypropane-1-sulfonic acid;N-methylprop-2-enamide |
|---|---|
| PubChem CID | 175329174 |
| Molecular Formula | C7H15NO5S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-hydroxypropane-1-sulfonic acid;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C4H7NO.C3H8O4S/c1-3-4(6)5-2;1-3(4)2-8(5,6)7/h3H,1H2,2H3,(H,5,6);3-4H,2H2,1H3,(H,5,6,7) |
| InChIKey | CCYUPEYSQHMFLL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|