C5H12NO4P — CID 160712581
methylphosphonic acid;N-methylprop-2-enamide (PubChem CID 160712581) has the molecular formula C5H12NO4P and a molecular weight of 181.13 g/mol. Its IUPAC name is methylphosphonic acid;N-methylprop-2-enamide.
| Compound Name | methylphosphonic acid;N-methylprop-2-enamide |
|---|---|
| PubChem CID | 160712581 |
| Molecular Formula | C5H12NO4P |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | methylphosphonic acid;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.CP(=O)(O)O |
| InChI | InChI=1S/C4H7NO.CH5O3P/c1-3-4(6)5-2;1-5(2,3)4/h3H,1H2,2H3,(H,5,6);1H3,(H2,2,3,4) |
| InChIKey | RSBADCVFOYTPRH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|