C8H16N2O2 — CID 174991436
N,N-dimethylacetamide;N-methylprop-2-enamide (PubChem CID 174991436) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N,N-dimethylacetamide;N-methylprop-2-enamide.
| Compound Name | N,N-dimethylacetamide;N-methylprop-2-enamide |
|---|---|
| PubChem CID | 174991436 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N,N-dimethylacetamide;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.CC(=O)N(C)C |
| InChI | InChI=1S/C4H9NO.C4H7NO/c1-4(6)5(2)3;1-3-4(6)5-2/h1-3H3;3H,1H2,2H3,(H,5,6) |
| InChIKey | XHLFFNUBTWRBSD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|