C13H24N2O2 — CID 91512805
N-ethylprop-2-enamide;N-methylprop-2-enamide;2-methylprop-1-ene (PubChem CID 91512805) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-ethylprop-2-enamide;N-methylprop-2-enamide;2-methylprop-1-ene.
| Compound Name | N-ethylprop-2-enamide;N-methylprop-2-enamide;2-methylprop-1-ene |
|---|---|
| PubChem CID | 91512805 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-ethylprop-2-enamide;N-methylprop-2-enamide;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CC(=O)NC.C=CC(=O)NCC |
| InChI | InChI=1S/C5H9NO.C4H7NO.C4H8/c1-3-5(7)6-4-2;1-3-4(6)5-2;1-4(2)3/h3H,1,4H2,2H3,(H,6,7);3H,1H2,2H3,(H,5,6);1H2,2-3H3 |
| InChIKey | CCLXHIXKYPAQFV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|