About N-ethylprop-2-enamide;N-methylmethanamine
N-ethylprop-2-enamide;N-methylmethanamine (PubChem CID 22381553) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is N-ethylprop-2-enamide;N-methylmethanamine.
Molecular Properties
| Compound Name | N-ethylprop-2-enamide;N-methylmethanamine |
| PubChem CID | 22381553 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-ethylprop-2-enamide;N-methylmethanamine |
| SMILES | C=CC(=O)NCC.CNC |
| InChI | InChI=1S/C5H9NO.C2H7N/c1-3-5(7)6-4-2;1-3-2/h3H,1,4H2,2H3,(H,6,7);3H,1-2H3 |
| InChIKey | JOLNFGHBHWJGBH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylprop-2-enamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylprop-2-enamide;N-methylmethanamine?
The IUPAC name of N-ethylprop-2-enamide;N-methylmethanamine (CID 22381553) is N-ethylprop-2-enamide;N-methylmethanamine.
What is the SMILES notation for N-ethylprop-2-enamide;N-methylmethanamine?
The canonical SMILES for N-ethylprop-2-enamide;N-methylmethanamine is C=CC(=O)NCC.CNC.
What is the InChIKey of N-ethylprop-2-enamide;N-methylmethanamine?
The InChIKey is JOLNFGHBHWJGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C2H7N/c1-3-5(7)6-4-2;1-3-2/h3H,1,4H2,2H3,(H,6,7);3H,1-2H3.
What are the key properties of N-ethylprop-2-enamide;N-methylmethanamine?
N-ethylprop-2-enamide;N-methylmethanamine has a molecular weight of 144.22 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylprop-2-enamide;N-methylmethanamine is sourced from PubChem (CID 22381553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).