C8H14N2O2 — CID 22015135
(E)-N,N'-diethylbut-2-enediamide (PubChem CID 22015135) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (E)-N,N'-diethylbut-2-enediamide.
| Compound Name | (E)-N,N'-diethylbut-2-enediamide |
|---|---|
| PubChem CID | 22015135 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (E)-N,N'-diethylbut-2-enediamide |
| SMILES | CCNC(=O)/C=C/C(=O)NCC |
| InChI | InChI=1S/C8H14N2O2/c1-3-9-7(11)5-6-8(12)10-4-2/h5-6H,3-4H2,1-2H3,(H,9,11)(H,10,12)/b6-5+ |
| InChIKey | CGDSXGVAJVNEME-AATRIKPKSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|