C9H13NO3 — CID 151233614
[3-(ethylamino)-3-oxoprop-1-enyl] 2-methylprop-2-enoate (PubChem CID 151233614) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is [3-(ethylamino)-3-oxoprop-1-enyl] 2-methylprop-2-enoate.
| Compound Name | [3-(ethylamino)-3-oxoprop-1-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151233614 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [3-(ethylamino)-3-oxoprop-1-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=CC(=O)NCC |
| InChI | InChI=1S/C9H13NO3/c1-4-10-8(11)5-6-13-9(12)7(2)3/h5-6H,2,4H2,1,3H3,(H,10,11) |
| InChIKey | NOUTWRHEWKNKRZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|