C16H32N2O3 — CID 161409865
2-(diethylamino)ethyl 2-methylprop-2-enoate;N-ethylprop-2-enamide;methane (PubChem CID 161409865) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methylprop-2-enoate;N-ethylprop-2-enamide;methane.
| Compound Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;N-ethylprop-2-enamide;methane |
|---|---|
| PubChem CID | 161409865 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;N-ethylprop-2-enamide;methane |
| SMILES | C.C=C(C)C(=O)OCCN(CC)CC.C=CC(=O)NCC |
| InChI | InChI=1S/C10H19NO2.C5H9NO.CH4/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-3-5(7)6-4-2;/h3,5-8H2,1-2,4H3;3H,1,4H2,2H3,(H,6,7);1H4 |
| InChIKey | VVIBMBCOVSIUSJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|