C16H31NO2 — CID 54255314
2-(dipentylamino)ethyl 2-methylprop-2-enoate (PubChem CID 54255314) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-(dipentylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(dipentylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54255314 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2-(dipentylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CCCCC)CCCCC |
| InChI | InChI=1S/C16H31NO2/c1-5-7-9-11-17(12-10-8-6-2)13-14-19-16(18)15(3)4/h3,5-14H2,1-2,4H3 |
| InChIKey | QZPNMGCDBMNEGL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|