About 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine
2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine (PubChem CID 161237625) has the molecular formula C10H23N3O2
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine |
| PubChem CID | 161237625 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine |
| SMILES | C=C(C)C(=O)OCCN(CC)CC.NN |
| InChI | InChI=1S/C10H19NO2.H4N2/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-2/h3,5-8H2,1-2,4H3;1-2H2 |
| InChIKey | UZOVDCJHCOPGCS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine?
The IUPAC name of 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine (CID 161237625) is 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine.
What is the SMILES notation for 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine?
The canonical SMILES for 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine is C=C(C)C(=O)OCCN(CC)CC.NN.
What is the InChIKey of 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine?
The InChIKey is UZOVDCJHCOPGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.H4N2/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-2/h3,5-8H2,1-2,4H3;1-2H2.
What are the key properties of 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine?
2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine has a molecular weight of 217.31 g/mol, XLogP of 0.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-methylprop-2-enoate;hydrazine is sourced from PubChem (CID 161237625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).