C14H29NO6S — CID 162214981
2-(diethylamino)ethyl 2-methylprop-2-enoate;diethyl sulfate (PubChem CID 162214981) has the molecular formula C14H29NO6S and a molecular weight of 339.45 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methylprop-2-enoate;diethyl sulfate.
| Compound Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;diethyl sulfate |
|---|---|
| PubChem CID | 162214981 |
| Molecular Formula | C14H29NO6S |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;diethyl sulfate |
| SMILES | C=C(C)C(=O)OCCN(CC)CC.CCOS(=O)(=O)OCC |
| InChI | InChI=1S/C10H19NO2.C4H10O4S/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-3-7-9(5,6)8-4-2/h3,5-8H2,1-2,4H3;3-4H2,1-2H3 |
| InChIKey | ZTIMEKYDOPYAGI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|