C19H31NO6 — CID 138744841
2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]amino]ethyl 2,2-dimethylpropanoate (PubChem CID 138744841) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]amino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]amino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138744841 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]amino]ethyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCN(CCOC(=O)C(=C)C)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H31NO6/c1-14(2)16(21)24-11-8-20(9-12-25-17(22)15(3)4)10-13-26-18(23)19(5,6)7/h1,3,8-13H2,2,4-7H3 |
| InChIKey | YCBDSUAEERJIEA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|