C25H37N3O9 — CID 146653245
3-[3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2,2-dimethylpropanoate (PubChem CID 146653245) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is 3-[3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146653245 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 3-[3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCn1c(=O)n(CCCOC(=O)C(=C)C)c(=O)n(CCCOC(=O)C(C)(C)C)c1=O |
| InChI | InChI=1S/C25H37N3O9/c1-17(2)19(29)35-14-8-11-26-22(32)27(12-9-15-36-20(30)18(3)4)24(34)28(23(26)33)13-10-16-37-21(31)25(5,6)7/h1,3,8-16H2,2,4-7H3 |
| InChIKey | LTAYKZCXUXKNOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|