C14H23BrO4 — CID 59782884
6-(2-methylprop-2-enoyloxy)hexyl 2-bromo-2-methylpropanoate (PubChem CID 59782884) has the molecular formula C14H23BrO4 and a molecular weight of 335.24 g/mol. Its IUPAC name is 6-(2-methylprop-2-enoyloxy)hexyl 2-bromo-2-methylpropanoate.
| Compound Name | 6-(2-methylprop-2-enoyloxy)hexyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 59782884 |
| Molecular Formula | C14H23BrO4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-(2-methylprop-2-enoyloxy)hexyl 2-bromo-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCCCCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C14H23BrO4/c1-11(2)12(16)18-9-7-5-6-8-10-19-13(17)14(3,4)15/h1,5-10H2,2-4H3 |
| InChIKey | XZUWYFYUBTZRMX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|