C20H29N3O8 — CID 68566366
3-[3-(3-hydroxypropyl)-5-[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2-methylprop-2-enoate (PubChem CID 68566366) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-[3-(3-hydroxypropyl)-5-[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-(3-hydroxypropyl)-5-[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 68566366 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-[3-(3-hydroxypropyl)-5-[3-(2-methylprop-2-enoyloxy)propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCn1c(=O)n(CCCO)c(=O)n(CCCOC(=O)C(=C)C)c1=O |
| InChI | InChI=1S/C20H29N3O8/c1-14(2)16(25)30-12-6-9-22-18(27)21(8-5-11-24)19(28)23(20(22)29)10-7-13-31-17(26)15(3)4/h24H,1,3,5-13H2,2,4H3 |
| InChIKey | SBHQUOMVAFIQRC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|