About 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one
3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one (PubChem CID 174654040) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one.
Molecular Properties
| Compound Name | 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one |
| PubChem CID | 174654040 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one |
| SMILES | C=C(C)C(=O)OCCCO.C=C1OC1=O |
| InChI | InChI=1S/C7H12O3.C3H2O2/c1-6(2)7(9)10-5-3-4-8;1-2-3(4)5-2/h8H,1,3-5H2,2H3;1H2 |
| InChIKey | PJYMNMHWSZYORW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one?
The IUPAC name of 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one (CID 174654040) is 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one.
What is the SMILES notation for 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one?
The canonical SMILES for 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one is C=C(C)C(=O)OCCCO.C=C1OC1=O.
What is the InChIKey of 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one?
The InChIKey is PJYMNMHWSZYORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C3H2O2/c1-6(2)7(9)10-5-3-4-8;1-2-3(4)5-2/h8H,1,3-5H2,2H3;1H2.
What are the key properties of 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one?
3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one has a molecular weight of 214.22 g/mol, XLogP of 0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl 2-methylprop-2-enoate;3-methylideneoxiran-2-one is sourced from PubChem (CID 174654040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).