About 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid
2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid (PubChem CID 162067648) has the molecular formula C6H16O9P2
and a molecular weight of 294.13 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid |
| PubChem CID | 162067648 |
| Molecular Formula | C6H16O9P2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid |
| SMILES | C=C(C)C(=O)OCCO.OP(O)O.OP(O)O |
| InChI | InChI=1S/C6H10O3.2H3O3P/c1-5(2)6(8)9-4-3-7;2*1-4(2)3/h7H,1,3-4H2,2H3;2*1-3H |
| InChIKey | ZAQXVFSPMVUDEF-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid (CID 162067648) is 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid is C=C(C)C(=O)OCCO.OP(O)O.OP(O)O.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The InChIKey is ZAQXVFSPMVUDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.2H3O3P/c1-5(2)6(8)9-4-3-7;2*1-4(2)3/h7H,1,3-4H2,2H3;2*1-3H.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid has a molecular weight of 294.13 g/mol, XLogP of -1.52, 3 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid is sourced from PubChem (CID 162067648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).