2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid

C6H16O9P2 — CID 162067648

IUPAC2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid
SMILESC=C(C)C(=O)OCCO.OP(O)O.OP(O)O
InChIInChI=1S/C6H10O3.2H3O3P/c1-5(2)6(8)9-4-3-7;2*1-4(2)3/h7H,1,3-4H2,2H3;2*1-3H
InChIKeyZAQXVFSPMVUDEF-UHFFFAOYSA-N
MW294.13 g/mol
LogP-1.52
Rot. Bonds3

About 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid

2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid (PubChem CID 162067648) has the molecular formula C6H16O9P2 and a molecular weight of 294.13 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid.

Molecular Properties

Compound Name2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid
PubChem CID162067648
Molecular FormulaC6H16O9P2
Molecular Weight294.13 g/mol
Exact Mass294.03
IUPAC Name2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid
SMILESC=C(C)C(=O)OCCO.OP(O)O.OP(O)O
InChIInChI=1S/C6H10O3.2H3O3P/c1-5(2)6(8)9-4-3-7;2*1-4(2)3/h7H,1,3-4H2,2H3;2*1-3H
InChIKeyZAQXVFSPMVUDEF-UHFFFAOYSA-N
XLogP-1.52
TPSA167.91 Ų
H-Bond Donors7
H-Bond Acceptors9
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500294.13
LogP ≤ 5-1.52
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid (CID 162067648) is 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid is C=C(C)C(=O)OCCO.OP(O)O.OP(O)O.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
The InChIKey is ZAQXVFSPMVUDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.2H3O3P/c1-5(2)6(8)9-4-3-7;2*1-4(2)3/h7H,1,3-4H2,2H3;2*1-3H.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid?
2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid has a molecular weight of 294.13 g/mol, XLogP of -1.52, 3 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;phosphorous acid is sourced from PubChem (CID 162067648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).